About 7,7-bis(ethenyl)nona-1,8-dien-3-amine
7,7-bis(ethenyl)nona-1,8-dien-3-amine (PubChem CID 172914372) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 7,7-bis(ethenyl)nona-1,8-dien-3-amine.
Molecular Properties
| Compound Name | 7,7-bis(ethenyl)nona-1,8-dien-3-amine |
| PubChem CID | 172914372 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 7,7-bis(ethenyl)nona-1,8-dien-3-amine |
| SMILES | C=CC(N)CCCC(C=C)(C=C)C=C |
| InChI | InChI=1S/C13H21N/c1-5-12(14)10-9-11-13(6-2,7-3)8-4/h5-8,12H,1-4,9-11,14H2 |
| InChIKey | YPOQKSPKXVYYKZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,7-bis(ethenyl)nona-1,8-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-bis(ethenyl)nona-1,8-dien-3-amine?
The IUPAC name of 7,7-bis(ethenyl)nona-1,8-dien-3-amine (CID 172914372) is 7,7-bis(ethenyl)nona-1,8-dien-3-amine.
What is the SMILES notation for 7,7-bis(ethenyl)nona-1,8-dien-3-amine?
The canonical SMILES for 7,7-bis(ethenyl)nona-1,8-dien-3-amine is C=CC(N)CCCC(C=C)(C=C)C=C.
What is the InChIKey of 7,7-bis(ethenyl)nona-1,8-dien-3-amine?
The InChIKey is YPOQKSPKXVYYKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-5-12(14)10-9-11-13(6-2,7-3)8-4/h5-8,12H,1-4,9-11,14H2.
What are the key properties of 7,7-bis(ethenyl)nona-1,8-dien-3-amine?
7,7-bis(ethenyl)nona-1,8-dien-3-amine has a molecular weight of 191.32 g/mol, XLogP of 3.21, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-bis(ethenyl)nona-1,8-dien-3-amine is sourced from PubChem (CID 172914372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).