C12H12N4O3 — CID 172914405
10-(3-hydroxypropyl)-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione (PubChem CID 172914405) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 10-(3-hydroxypropyl)-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione.
| Compound Name | 10-(3-hydroxypropyl)-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione |
|---|---|
| PubChem CID | 172914405 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 10-(3-hydroxypropyl)-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione |
| SMILES | O=c1[nH]nc2n(CCCO)c3ccccc3n2c1=O |
| InChI | InChI=1S/C12H12N4O3/c17-7-3-6-15-8-4-1-2-5-9(8)16-11(19)10(18)13-14-12(15)16/h1-2,4-5,17H,3,6-7H2,(H,13,18) |
| InChIKey | BKRWWHVTSXBVEV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|