About 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole
5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole (PubChem CID 172914435) has the molecular formula C17H13ClN4O2
and a molecular weight of 340.77 g/mol. Its IUPAC name is 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole |
| PubChem CID | 172914435 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(Cn3ccc4c(Cl)ncnc43)on2)cc1 |
| InChI | InChI=1S/C17H13ClN4O2/c1-23-12-4-2-11(3-5-12)15-8-13(24-21-15)9-22-7-6-14-16(18)19-10-20-17(14)22/h2-8,10H,9H2,1H3 |
| InChIKey | QVVYZUREWBLNQM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The IUPAC name of 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole (CID 172914435) is 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole.
What is the SMILES notation for 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The canonical SMILES for 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole is COc1ccc(-c2cc(Cn3ccc4c(Cl)ncnc43)on2)cc1.
What is the InChIKey of 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole?
The InChIKey is QVVYZUREWBLNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O2/c1-23-12-4-2-11(3-5-12)15-8-13(24-21-15)9-22-7-6-14-16(18)19-10-20-17(14)22/h2-8,10H,9H2,1H3.
What are the key properties of 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole?
5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole has a molecular weight of 340.77 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)methyl]-3-(4-methoxyphenyl)-1,2-oxazole is sourced from PubChem (CID 172914435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).