C12H3F17O3 — CID 172915002
(Z)-3,4,4,5,5,6,6,7,7-nonafluoro-7-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]hept-2-enoic acid (PubChem CID 172915002) has the molecular formula C12H3F17O3 and a molecular weight of 518.12 g/mol. Its IUPAC name is (Z)-3,4,4,5,5,6,6,7,7-nonafluoro-7-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]hept-2-enoic acid.
| Compound Name | (Z)-3,4,4,5,5,6,6,7,7-nonafluoro-7-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 172915002 |
| Molecular Formula | C12H3F17O3 |
| Molecular Weight | 518.12 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | (Z)-3,4,4,5,5,6,6,7,7-nonafluoro-7-[3-fluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)oxiran-2-yl]hept-2-enoic acid |
| SMILES | O=C(O)/C=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1OC1(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F17O3/c13-2(1-3(30)31)5(14,15)8(19,20)9(21,22)6(16,17)4-7(18,32-4)10(23,24)11(25,26)12(27,28)29/h1,4H,(H,30,31)/b2-1- |
| InChIKey | IZAYPKWAXSOCAU-UPHRSURJSA-N |
| XLogP | 5.36 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.12 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|