C8H10F5NO — CID 172915019
(2S,3S,5R,6R)-1,2,3,5,6-pentafluoro-N-methylcyclohexane-1-carboxamide (PubChem CID 172915019) has the molecular formula C8H10F5NO and a molecular weight of 231.16 g/mol. Its IUPAC name is (2S,3S,5R,6R)-1,2,3,5,6-pentafluoro-N-methylcyclohexane-1-carboxamide.
| Compound Name | (2S,3S,5R,6R)-1,2,3,5,6-pentafluoro-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 172915019 |
| Molecular Formula | C8H10F5NO |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2S,3S,5R,6R)-1,2,3,5,6-pentafluoro-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(F)[C@H](F)[C@H](F)C[C@H](F)[C@@H]1F |
| InChI | InChI=1S/C8H10F5NO/c1-14-7(15)8(13)5(11)3(9)2-4(10)6(8)12/h3-6H,2H2,1H3,(H,14,15)/t3-,4+,5-,6+,8? |
| InChIKey | CVIXGTIYOGCVCX-DTDYPOIKSA-N |
| XLogP | 1.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |