C32H34FN13O2S — CID 172915094
4-(2,4-diamino-8-phenyl-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl)-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 172915094) has the molecular formula C32H34FN13O2S and a molecular weight of 683.78 g/mol. Its IUPAC name is 4-(2,4-diamino-8-phenyl-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl)-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-(2,4-diamino-8-phenyl-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl)-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 172915094 |
| Molecular Formula | C32H34FN13O2S |
| Molecular Weight | 683.78 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 4-(2,4-diamino-8-phenyl-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl)-N-[2-[[4-(dimethylamino)-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CN(C)c1nc(NCCNS(=O)(=O)c2ccc(C3=Nc4c(N)nc(N)nc4NC(c4ccccc4)C3)cc2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C32H34FN13O2S/c1-46(2)32-44-30(43-31(45-32)38-22-12-10-21(33)11-13-22)36-16-17-37-49(47,48)23-14-8-20(9-15-23)24-18-25(19-6-4-3-5-7-19)40-28-26(39-24)27(34)41-29(35)42-28/h3-15,25,37H,16-18H2,1-2H3,(H5,34,35,40,41,42)(H2,36,38,43,44,45) |
| InChIKey | SEHCLLKGADTFBI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|