C27H28N2O7 — CID 172915109
20-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione (PubChem CID 172915109) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is 20-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione.
| Compound Name | 20-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
|---|---|
| PubChem CID | 172915109 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 20-[3-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
| SMILES | COc1cc2c3c(n(CCCN4CCC[C@@H]4CO)c(=O)c2cc1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C27H28N2O7/c1-33-20-9-16-19(12-21(20)34-2)27(32)29(8-4-7-28-6-3-5-15(28)13-30)25-17-10-22-23(36-14-35-22)11-18(17)26(31)24(16)25/h9-12,15,30H,3-8,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | IYSJPMMWYZVAHU-OAHLLOKOSA-N |
| XLogP | 2.81 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|