C16H13BrN2O2 — CID 172915780
2-[3,5-bis(trideuteriomethoxy)phenyl]-6-bromoquinazoline (PubChem CID 172915780) has the molecular formula C16H13BrN2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-[3,5-bis(trideuteriomethoxy)phenyl]-6-bromoquinazoline.
| Compound Name | 2-[3,5-bis(trideuteriomethoxy)phenyl]-6-bromoquinazoline |
|---|---|
| PubChem CID | 172915780 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[3,5-bis(trideuteriomethoxy)phenyl]-6-bromoquinazoline |
| SMILES | [2H]C([2H])([2H])Oc1cc(OC([2H])([2H])[2H])cc(-c2ncc3cc(Br)ccc3n2)c1 |
| InChI | InChI=1S/C16H13BrN2O2/c1-20-13-6-10(7-14(8-13)21-2)16-18-9-11-5-12(17)3-4-15(11)19-16/h3-9H,1-2H3/i1D3,2D3 |
| InChIKey | XYFKPURAQSDXFE-WFGJKAKNSA-N |
| XLogP | 4.08 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |