C8H12O4 — CID 172915854
(9S)-9-methyl-1,4,8-trioxaspiro[4.5]decan-7-one (PubChem CID 172915854) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (9S)-9-methyl-1,4,8-trioxaspiro[4.5]decan-7-one.
| Compound Name | (9S)-9-methyl-1,4,8-trioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 172915854 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (9S)-9-methyl-1,4,8-trioxaspiro[4.5]decan-7-one |
| SMILES | C[C@H]1CC2(CC(=O)O1)OCCO2 |
| InChI | InChI=1S/C8H12O4/c1-6-4-8(5-7(9)12-6)10-2-3-11-8/h6H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | XYKXCBOTXOVNMC-LURJTMIESA-N |
| XLogP | 0.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |