About (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride
(3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride (PubChem CID 172915873) has the molecular formula C4H10ClF3N2O
and a molecular weight of 194.58 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride |
| PubChem CID | 172915873 |
| Molecular Formula | C4H10ClF3N2O |
| Molecular Weight | 194.58 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride |
| SMILES | Cl.NN[C@@H](CCO)C(F)(F)F |
| InChI | InChI=1S/C4H9F3N2O.ClH/c5-4(6,7)3(9-8)1-2-10;/h3,9-10H,1-2,8H2;1H/t3-;/m0./s1 |
| InChIKey | YWGMRZZVDAPPPB-DFWYDOINSA-N |
| XLogP | 0.18 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.58 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride?
The IUPAC name of (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride (CID 172915873) is (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride.
What is the SMILES notation for (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride?
The canonical SMILES for (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride is Cl.NN[C@@H](CCO)C(F)(F)F.
What is the InChIKey of (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride?
The InChIKey is YWGMRZZVDAPPPB-DFWYDOINSA-N. The full InChI is InChI=1S/C4H9F3N2O.ClH/c5-4(6,7)3(9-8)1-2-10;/h3,9-10H,1-2,8H2;1H/t3-;/m0./s1.
What are the key properties of (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride?
(3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride has a molecular weight of 194.58 g/mol, XLogP of 0.18, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4,4-trifluoro-3-hydrazinylbutan-1-ol;hydrochloride is sourced from PubChem (CID 172915873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).