C35H49ClNiO3P2- — CID 172916112
chloronickel;dicyclohexyl-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)phenyl]phosphane;methylbenzene (PubChem CID 172916112) has the molecular formula C35H49ClNiO3P2- and a molecular weight of 673.87 g/mol. Its IUPAC name is chloronickel;dicyclohexyl-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)phenyl]phosphane;methylbenzene.
| Compound Name | chloronickel;dicyclohexyl-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)phenyl]phosphane;methylbenzene |
|---|---|
| PubChem CID | 172916112 |
| Molecular Formula | C35H49ClNiO3P2- |
| Molecular Weight | 673.87 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | chloronickel;dicyclohexyl-[2-(1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decan-8-yl)phenyl]phosphane;methylbenzene |
| SMILES | CC12CC3(C)OC(C)(CC(C)(O1)P3c1ccccc1P(C1CCCCC1)C1CCCCC1)O2.Cc1[c-]cccc1.Cl[Ni] |
| InChI | InChI=1S/C28H42O3P2.C7H7.ClH.Ni/c1-25-19-27(3)31-26(2,29-25)20-28(4,30-25)33(27)24-18-12-11-17-23(24)32(21-13-7-5-8-14-21)22-15-9-6-10-16-22;1-7-5-3-2-4-6-7;;/h11-12,17-18,21-22H,5-10,13-16,19-20H2,1-4H3;2-5H,1H3;1H;/q;-1;;+1/p-1 |
| InChIKey | VPIXAYLCZAIRNS-UHFFFAOYSA-M |
| XLogP | 9.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.87 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|