C23H31ClN2O4 — CID 172916443
4-chloro-2-[(2E,4E)-5-[(1R,2R,5E)-5-hydroxyimino-1,2-dimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxyiminomethyl]-3-methoxy-5-methylphenol (PubChem CID 172916443) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is 4-chloro-2-[(2E,4E)-5-[(1R,2R,5E)-5-hydroxyimino-1,2-dimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxyiminomethyl]-3-methoxy-5-methylphenol.
| Compound Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,5E)-5-hydroxyimino-1,2-dimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxyiminomethyl]-3-methoxy-5-methylphenol |
|---|---|
| PubChem CID | 172916443 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,5E)-5-hydroxyimino-1,2-dimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-[(E)-hydroxyiminomethyl]-3-methoxy-5-methylphenol |
| SMILES | COc1c(Cl)c(C)c(/C=N/O)c(O)c1C/C=C(C)/C=C/[C@]1(C)C/C(=N/O)CC[C@H]1C |
| InChI | InChI=1S/C23H31ClN2O4/c1-14(10-11-23(4)12-17(26-29)8-7-15(23)2)6-9-18-21(27)19(13-25-28)16(3)20(24)22(18)30-5/h6,10-11,13,15,27-29H,7-9,12H2,1-5H3/b11-10+,14-6+,25-13+,26-17+/t15-,23-/m1/s1 |
| InChIKey | IZIPJAJBEZXFLN-FETRSGDXSA-N |
| XLogP | 5.87 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|