C12H21NO11S2 — CID 172916732
methyl (5Z)-5-sulfooxyimino-5-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentanoate (PubChem CID 172916732) has the molecular formula C12H21NO11S2 and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl (5Z)-5-sulfooxyimino-5-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentanoate.
| Compound Name | methyl (5Z)-5-sulfooxyimino-5-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentanoate |
|---|---|
| PubChem CID | 172916732 |
| Molecular Formula | C12H21NO11S2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | methyl (5Z)-5-sulfooxyimino-5-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentanoate |
| SMILES | COC(=O)CCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21NO11S2/c1-22-8(15)4-2-3-7(13-24-26(19,20)21)25-12-11(18)10(17)9(16)6(5-14)23-12/h6,9-12,14,16-18H,2-5H2,1H3,(H,19,20,21)/b13-7-/t6-,9+,10+,11+,12+/m1/s1 |
| InChIKey | WHBSQLXMQPNRIX-OMMQSYDBSA-N |
| XLogP | -2.00 |
| TPSA | 192.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|