C28H36Cl2N8O — CID 172917726
4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;4-methoxy-N-methyl-N-[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]aniline;dichloride (PubChem CID 172917726) has the molecular formula C28H36Cl2N8O and a molecular weight of 571.56 g/mol. Its IUPAC name is 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;4-methoxy-N-methyl-N-[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]aniline;dichloride.
| Compound Name | 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;4-methoxy-N-methyl-N-[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]aniline;dichloride |
|---|---|
| PubChem CID | 172917726 |
| Molecular Formula | C28H36Cl2N8O |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;4-methoxy-N-methyl-N-[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]aniline;dichloride |
| SMILES | CN(C)c1ccc(/N=N/c2n(C)cc[n+]2C)cc1.COc1ccc(N(C)/N=C/c2cc[n+](C)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C15H18N3O.C13H18N5.2ClH/c1-17-10-8-13(9-11-17)12-16-18(2)14-4-6-15(19-3)7-5-14;1-16(2)12-7-5-11(6-8-12)14-15-13-17(3)9-10-18(13)4;;/h4-12H,1-3H3;5-10H,1-4H3;2*1H/q2*+1;;/p-2 |
| InChIKey | IDSUSKIPSNGUGT-UHFFFAOYSA-L |
| XLogP | -1.67 |
| TPSA | 65.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|