About 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine
1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine (PubChem CID 172918086) has the molecular formula C31H27N5
and a molecular weight of 469.59 g/mol. Its IUPAC name is 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine.
Molecular Properties
| Compound Name | 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine |
| PubChem CID | 172918086 |
| Molecular Formula | C31H27N5 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine |
| SMILES | NC(=N/N=C/C(=C/c1ccccc1)c1ccccc1)N/N=C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27N5/c32-31(35-33-23-29(27-17-9-3-10-18-27)21-25-13-5-1-6-14-25)36-34-24-30(28-19-11-4-12-20-28)22-26-15-7-2-8-16-26/h1-24H,(H3,32,35,36)/b29-21-,30-22-,33-23+,34-24+ |
| InChIKey | VUDZRUMJQQFYLQ-UONFLDSWSA-N |
| XLogP | 6.34 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine?
The IUPAC name of 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine (CID 172918086) is 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine.
What is the SMILES notation for 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine?
The canonical SMILES for 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine is NC(=N/N=C/C(=C/c1ccccc1)c1ccccc1)N/N=C/C(=C/c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine?
The InChIKey is VUDZRUMJQQFYLQ-UONFLDSWSA-N. The full InChI is InChI=1S/C31H27N5/c32-31(35-33-23-29(27-17-9-3-10-18-27)21-25-13-5-1-6-14-25)36-34-24-30(28-19-11-4-12-20-28)22-26-15-7-2-8-16-26/h1-24H,(H3,32,35,36)/b29-21-,30-22-,33-23+,34-24+.
What are the key properties of 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine?
1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine has a molecular weight of 469.59 g/mol, XLogP of 6.34, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis[(E)-[(E)-2,3-diphenylprop-2-enylidene]amino]guanidine is sourced from PubChem (CID 172918086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).