C15H19N7 — CID 172918425
N-[(E)-[4-(4,5-dihydro-1H-imidazol-2-ylmethyliminomethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 172918425) has the molecular formula C15H19N7 and a molecular weight of 297.37 g/mol. Its IUPAC name is N-[(E)-[4-(4,5-dihydro-1H-imidazol-2-ylmethyliminomethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[(E)-[4-(4,5-dihydro-1H-imidazol-2-ylmethyliminomethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 172918425 |
| Molecular Formula | C15H19N7 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(E)-[4-(4,5-dihydro-1H-imidazol-2-ylmethyliminomethyl)phenyl]methylideneamino]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C(=N/CC1=NCCN1)\c1ccc(/C=N/NC2=NCCN2)cc1 |
| InChI | InChI=1S/C15H19N7/c1-3-13(10-21-22-15-19-7-8-20-15)4-2-12(1)9-16-11-14-17-5-6-18-14/h1-4,9-10H,5-8,11H2,(H,17,18)(H2,19,20,22)/b16-9+,21-10+ |
| InChIKey | DVPKPBYMTPYHTQ-PGZNPFONSA-N |
| XLogP | -0.01 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|