C53H65FN12O13S2 — CID 172918532
CID 172918532 (PubChem CID 172918532) has the molecular formula C53H65FN12O13S2 and a molecular weight of 1163.31 g/mol.
| Compound Name | CID 172918532 |
|---|---|
| PubChem CID | 172918532 |
| Molecular Formula | C53H65FN12O13S2 |
| Molecular Weight | 1163.31 g/mol |
| Exact Mass | 1162.43 |
| IUPAC Name | — |
| SMILES | C.Cc1cc(C)c(S(=O)(=O)N=C(CNC(=O)c2cn(CCCNC(=O)CCC(=O)NCCCOCCCNC(=O)c3ccc(N/N=C/c4ccccc4S(=O)(=O)O)nc3)c3cc(CNc4ncc[nH]4)ccc3c2=O)C(=O)O)c(C)c1.[3H]F |
| InChI | InChI=1S/C52H60N12O13S2.CH4.FH/c1-33-25-34(2)48(35(3)26-33)78(72,73)63-41(51(70)71)31-59-50(69)40-32-64(42-27-36(11-13-39(42)47(40)67)28-60-52-56-20-21-57-52)22-6-17-53-45(65)15-16-46(66)54-18-7-23-77-24-8-19-55-49(68)38-12-14-44(58-29-38)62-61-30-37-9-4-5-10-43(37)79(74,75)76;;/h4-5,9-14,20-21,25-27,29-30,32H,6-8,15-19,22-24,28,31H2,1-3H3,(H,53,65)(H,54,66)(H,55,68)(H,58,62)(H,59,69)(H,70,71)(H2,56,57,60)(H,74,75,76);1H4;1H/b61-30+,63-41?;;/i/hT |
| InChIKey | BXNWLMJUQJXNHA-CMDRMLTKSA-N |
| XLogP | 4.41 |
| TPSA | 363.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|