About [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate
[(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate (PubChem CID 172919962) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate.
Molecular Properties
| Compound Name | [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate |
| PubChem CID | 172919962 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate |
| SMILES | O=C(O/N=C/C1=CCC(O)CC1)C12CC3CC4CC(C1)C42C3 |
| InChI | InChI=1S/C18H23NO3/c20-15-3-1-11(2-4-15)10-19-22-16(21)17-7-12-5-13-6-14(9-17)18(13,17)8-12/h1,10,12-15,20H,2-9H2/b19-10+ |
| InChIKey | OZPGYPAFCKDHOF-VXLYETTFSA-N |
| XLogP | 2.81 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate?
The IUPAC name of [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate (CID 172919962) is [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate.
What is the SMILES notation for [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate?
The canonical SMILES for [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate is O=C(O/N=C/C1=CCC(O)CC1)C12CC3CC4CC(C1)C42C3.
What is the InChIKey of [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate?
The InChIKey is OZPGYPAFCKDHOF-VXLYETTFSA-N. The full InChI is InChI=1S/C18H23NO3/c20-15-3-1-11(2-4-15)10-19-22-16(21)17-7-12-5-13-6-14(9-17)18(13,17)8-12/h1,10,12-15,20H,2-9H2/b19-10+.
What are the key properties of [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate?
[(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate has a molecular weight of 301.39 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(4-hydroxycyclohexen-1-yl)methylideneamino] tetracyclo[5.2.1.03,8.05,8]decane-3-carboxylate is sourced from PubChem (CID 172919962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).