C6H8N2O3 — CID 17292
5-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 17292) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 5-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 17292 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 5-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N2O3/c1-2-3-4(9)7-6(11)8-5(3)10/h3H,2H2,1H3,(H2,7,8,9,10,11) |
| InChIKey | FMTLDVACNZDTQL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|