About 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate
1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate (PubChem CID 172920449) has the molecular formula C17H23Cl3N4O2
and a molecular weight of 421.76 g/mol. Its IUPAC name is 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate.
Molecular Properties
| Compound Name | 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate |
| PubChem CID | 172920449 |
| Molecular Formula | C17H23Cl3N4O2 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate |
| SMILES | C.C.COC(=O)/C=N/Nc1ccc(Cl)cc1.ClNNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClN2O2.C6H6Cl2N2.2CH4/c1-14-9(13)6-11-12-8-4-2-7(10)3-5-8;7-5-1-3-6(4-2-5)9-10-8;;/h2-6,12H,1H3;1-4,9-10H;2*1H4/b11-6+;;; |
| InChIKey | XWPDDZQEVWVDAY-RZWKJUAESA-N |
| XLogP | 5.59 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate?
The IUPAC name of 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate (CID 172920449) is 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate.
What is the SMILES notation for 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate?
The canonical SMILES for 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate is C.C.COC(=O)/C=N/Nc1ccc(Cl)cc1.ClNNc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate?
The InChIKey is XWPDDZQEVWVDAY-RZWKJUAESA-N. The full InChI is InChI=1S/C9H9ClN2O2.C6H6Cl2N2.2CH4/c1-14-9(13)6-11-12-8-4-2-7(10)3-5-8;7-5-1-3-6(4-2-5)9-10-8;;/h2-6,12H,1H3;1-4,9-10H;2*1H4/b11-6+;;;.
What are the key properties of 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate?
1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate has a molecular weight of 421.76 g/mol, XLogP of 5.59, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(4-chlorophenyl)hydrazine;methane;methyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]acetate is sourced from PubChem (CID 172920449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).