C24H28N6O — CID 172921873
(1S,5R)-6-isocyano-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;(NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine (PubChem CID 172921873) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is (1S,5R)-6-isocyano-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;(NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine.
| Compound Name | (1S,5R)-6-isocyano-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;(NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172921873 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (1S,5R)-6-isocyano-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;(NE)-N-[[(1R,5S)-3-(5-methyl-2-pyridinyl)-3-azabicyclo[3.1.0]hexan-6-yl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(N2C[C@@H]3C(/C=N/O)[C@@H]3C2)nc1.[C-]#[N+]C1[C@H]2CN(c3ccc(C)cn3)C[C@@H]12 |
| InChI | InChI=1S/C12H15N3O.C12H13N3/c1-8-2-3-12(13-4-8)15-6-10-9(5-14-16)11(10)7-15;1-8-3-4-11(14-5-8)15-6-9-10(7-15)12(9)13-2/h2-5,9-11,16H,6-7H2,1H3;3-5,9-10,12H,6-7H2,1H3/b14-5+;/t9?,10-,11+;9-,10+,12? |
| InChIKey | SJTKZLTZJVNZQF-WFRLEHIESA-N |
| XLogP | 3.28 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|