About 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride
3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride (PubChem CID 172922695) has the molecular formula C4H9F2N3O
and a molecular weight of 153.13 g/mol. Its IUPAC name is 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride.
Molecular Properties
| Compound Name | 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride |
| PubChem CID | 172922695 |
| Molecular Formula | C4H9F2N3O |
| Molecular Weight | 153.13 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride |
| SMILES | C=C(N)CF.N/C(F)=N\O |
| InChI | InChI=1S/C3H6FN.CH3FN2O/c1-3(5)2-4;2-1(3)4-5/h1-2,5H2;5H,(H2,3,4) |
| InChIKey | RNYFBZIXYHYXIL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride?
The IUPAC name of 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride (CID 172922695) is 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride.
What is the SMILES notation for 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride?
The canonical SMILES for 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride is C=C(N)CF.N/C(F)=N\O.
What is the InChIKey of 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride?
The InChIKey is RNYFBZIXYHYXIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6FN.CH3FN2O/c1-3(5)2-4;2-1(3)4-5/h1-2,5H2;5H,(H2,3,4).
What are the key properties of 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride?
3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride has a molecular weight of 153.13 g/mol, XLogP of 0.09, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroprop-1-en-2-amine;N'-hydroxycarbamimidoyl fluoride is sourced from PubChem (CID 172922695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).