C23H23N5O5 — CID 172922905
1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;(10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;methane (PubChem CID 172922905) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;(10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;methane.
| Compound Name | 1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;(10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;methane |
|---|---|
| PubChem CID | 172922905 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;(10Z)-10-hydroxyimino-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2,9-dione;methane |
| SMILES | C.O=C1/C(=N\O)CCn2c(=O)[nH]c3cccc1c32.O=C1CCCn2c(=O)[nH]c3cccc1c32 |
| InChI | InChI=1S/C11H9N3O3.C11H10N2O2.CH4/c15-10-6-2-1-3-7-9(6)14(11(16)12-7)5-4-8(10)13-17;14-9-5-2-6-13-10-7(9)3-1-4-8(10)12-11(13)15;/h1-3,17H,4-5H2,(H,12,16);1,3-4H,2,5-6H2,(H,12,15);1H4/b13-8-;; |
| InChIKey | MFZRSIWSAIOVHL-KEZMYAPCSA-N |
| XLogP | 2.69 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|