C18H24N4 — CID 172923036
4-N-[(Z)-[4-(4-aminocyclohexyl)cyclohexa-2,4-dien-1-ylidene]amino]benzene-1,4-diamine (PubChem CID 172923036) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-N-[(Z)-[4-(4-aminocyclohexyl)cyclohexa-2,4-dien-1-ylidene]amino]benzene-1,4-diamine.
| Compound Name | 4-N-[(Z)-[4-(4-aminocyclohexyl)cyclohexa-2,4-dien-1-ylidene]amino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 172923036 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-N-[(Z)-[4-(4-aminocyclohexyl)cyclohexa-2,4-dien-1-ylidene]amino]benzene-1,4-diamine |
| SMILES | Nc1ccc(N/N=C2\C=CC(C3CCC(N)CC3)=CC2)cc1 |
| InChI | InChI=1S/C18H24N4/c19-15-5-1-13(2-6-15)14-3-9-17(10-4-14)21-22-18-11-7-16(20)8-12-18/h3-4,7-9,11-13,15,22H,1-2,5-6,10,19-20H2/b21-17+ |
| InChIKey | GMOXFPIRVDIYBL-HEHNFIMWSA-N |
| XLogP | 3.44 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|