C28H27Cl2IN2O5 — CID 172923222
2,4-dichloro-6-[(E)-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]iminomethyl]phenol iodide (PubChem CID 172923222) has the molecular formula C28H27Cl2IN2O5 and a molecular weight of 669.34 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]iminomethyl]phenol iodide.
| Compound Name | 2,4-dichloro-6-[(E)-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]iminomethyl]phenol iodide |
|---|---|
| PubChem CID | 172923222 |
| Molecular Formula | C28H27Cl2IN2O5 |
| Molecular Weight | 669.34 g/mol |
| Exact Mass | 668.03 |
| IUPAC Name | 2,4-dichloro-6-[(E)-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3-methylisoquinolin-2-ium-2-yl]iminomethyl]phenol iodide |
| SMILES | COc1ccc(Cc2c3cc(OC)c(OC)cc3cc(C)[n+]2/N=C/c2cc(Cl)cc(Cl)c2O)cc1OC.[I-] |
| InChI | InChI=1S/C28H26Cl2N2O5.HI/c1-16-8-18-12-26(36-4)27(37-5)14-21(18)23(9-17-6-7-24(34-2)25(10-17)35-3)32(16)31-15-19-11-20(29)13-22(30)28(19)33;/h6-8,10-15H,9H2,1-5H3;1H |
| InChIKey | ACOSYMBLBWHEKQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|