C19H24Br2N6 — CID 172923247
2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1,1-dimethylguanidine;bromide;hydrobromide (PubChem CID 172923247) has the molecular formula C19H24Br2N6 and a molecular weight of 496.25 g/mol. Its IUPAC name is 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1,1-dimethylguanidine;bromide;hydrobromide.
| Compound Name | 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1,1-dimethylguanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 172923247 |
| Molecular Formula | C19H24Br2N6 |
| Molecular Weight | 496.25 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 2-[(E)-[4-(1,6-dimethylimidazo[1,2-a]pyridin-4-ium-2-yl)phenyl]methylideneamino]-1,1-dimethylguanidine;bromide;hydrobromide |
| SMILES | Br.Cc1ccc2n(C)c(-c3ccc(/C=N/N=C(N)N(C)C)cc3)c[n+]2c1.[Br-] |
| InChI | InChI=1S/C19H23N6.2BrH/c1-14-5-10-18-24(4)17(13-25(18)12-14)16-8-6-15(7-9-16)11-21-22-19(20)23(2)3;;/h5-13H,1-4H3,(H2,20,22);2*1H/q+1;;/p-1/b21-11+;; |
| InChIKey | CCLFEYGVSBMWBB-JVCHBHOBSA-M |
| XLogP | -0.47 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|