C19H26IN5O4 — CID 172924169
5-butyl-2-[(E)-1-(4-iodopiperazin-1-yl)butylideneamino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 172924169) has the molecular formula C19H26IN5O4 and a molecular weight of 515.35 g/mol. Its IUPAC name is 5-butyl-2-[(E)-1-(4-iodopiperazin-1-yl)butylideneamino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-butyl-2-[(E)-1-(4-iodopiperazin-1-yl)butylideneamino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 172924169 |
| Molecular Formula | C19H26IN5O4 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 5-butyl-2-[(E)-1-(4-iodopiperazin-1-yl)butylideneamino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCCc1cc(=O)oc2nc(O/N=C(\CCC)N3CCN(I)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C19H26IN5O4/c1-3-5-7-13-12-15(26)28-18-16(13)17(27)21-19(22-18)29-23-14(6-4-2)24-8-10-25(20)11-9-24/h12H,3-11H2,1-2H3,(H,21,22,27)/b23-14+ |
| InChIKey | JHXWUWGZIYNMBZ-OEAKJJBVSA-N |
| XLogP | 2.68 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|