C16H14FN5O3S — CID 172927178
methyl (2E)-2-[(2Z)-2-[[3-cyano-2-(dimethylamino)-6-fluorophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927178) has the molecular formula C16H14FN5O3S and a molecular weight of 375.39 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[3-cyano-2-(dimethylamino)-6-fluorophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[3-cyano-2-(dimethylamino)-6-fluorophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927178 |
| Molecular Formula | C16H14FN5O3S |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[3-cyano-2-(dimethylamino)-6-fluorophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2c(F)ccc(C#N)c2N(C)C)NC1=O |
| InChI | InChI=1S/C16H14FN5O3S/c1-22(2)14-9(7-18)4-5-11(17)10(14)8-19-21-16-20-15(24)12(26-16)6-13(23)25-3/h4-6,8H,1-3H3,(H,20,21,24)/b12-6+,19-8? |
| InChIKey | QEKBSDZCXKORMP-MOIDRVSESA-N |
| XLogP | 1.37 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|