About (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol
(2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol (PubChem CID 172927681) has the molecular formula C6H16N2O4
and a molecular weight of 180.20 g/mol. Its IUPAC name is (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol.
Molecular Properties
| Compound Name | (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol |
| PubChem CID | 172927681 |
| Molecular Formula | C6H16N2O4 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol |
| SMILES | C/C(=N\N(C)C)C(O)O.OCO |
| InChI | InChI=1S/C5H12N2O2.CH4O2/c1-4(5(8)9)6-7(2)3;2-1-3/h5,8-9H,1-3H3;2-3H,1H2/b6-4+; |
| InChIKey | OESALCHQECBMPO-CVDVRWGVSA-N |
| XLogP | -1.84 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol?
The IUPAC name of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol (CID 172927681) is (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol.
What is the SMILES notation for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol?
The canonical SMILES for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol is C/C(=N\N(C)C)C(O)O.OCO.
What is the InChIKey of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol?
The InChIKey is OESALCHQECBMPO-CVDVRWGVSA-N. The full InChI is InChI=1S/C5H12N2O2.CH4O2/c1-4(5(8)9)6-7(2)3;2-1-3/h5,8-9H,1-3H3;2-3H,1H2/b6-4+;.
What are the key properties of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol?
(2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol has a molecular weight of 180.20 g/mol, XLogP of -1.84, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol;methanediol is sourced from PubChem (CID 172927681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).