C19H23NO7 — CID 172928320
(1S,2R,3R,4E,7S,9R,14R,16R)-2-hydroxy-4-hydroxyimino-7,9,16-trimethyl-13,17-dioxatetracyclo[9.5.2.03,14.014,18]octadec-11(18)-ene-6,10,12-trione (PubChem CID 172928320) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is (1S,2R,3R,4E,7S,9R,14R,16R)-2-hydroxy-4-hydroxyimino-7,9,16-trimethyl-13,17-dioxatetracyclo[9.5.2.03,14.014,18]octadec-11(18)-ene-6,10,12-trione.
| Compound Name | (1S,2R,3R,4E,7S,9R,14R,16R)-2-hydroxy-4-hydroxyimino-7,9,16-trimethyl-13,17-dioxatetracyclo[9.5.2.03,14.014,18]octadec-11(18)-ene-6,10,12-trione |
|---|---|
| PubChem CID | 172928320 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (1S,2R,3R,4E,7S,9R,14R,16R)-2-hydroxy-4-hydroxyimino-7,9,16-trimethyl-13,17-dioxatetracyclo[9.5.2.03,14.014,18]octadec-11(18)-ene-6,10,12-trione |
| SMILES | C[C@@H]1C[C@H](C)C(=O)C/C(=N\O)[C@@H]2[C@@H](O)[C@H]3OC4=C(C(=O)O[C@@]42C[C@H]3C)C1=O |
| InChI | InChI=1S/C19H23NO7/c1-7-4-8(2)14(22)12-17-19(27-18(12)24)6-9(3)16(26-17)15(23)13(19)10(20-25)5-11(7)21/h7-9,13,15-16,23,25H,4-6H2,1-3H3/b20-10+/t7-,8+,9+,13+,15+,16-,19+/m0/s1 |
| InChIKey | FHTFDKWORXYZHH-OFFCDPSSSA-N |
| XLogP | 0.99 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|