C31H40N4O2 — CID 172928514
3-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxy-N,N-dimethylpropanamide;methane (PubChem CID 172928514) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is 3-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxy-N,N-dimethylpropanamide;methane.
| Compound Name | 3-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxy-N,N-dimethylpropanamide;methane |
|---|---|
| PubChem CID | 172928514 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 3-[(E)-[10-[3-(benzylamino)propyl]-3,4-dimethylacridin-9-ylidene]amino]oxy-N,N-dimethylpropanamide;methane |
| SMILES | C.Cc1ccc2/c(=N/OCCC(=O)N(C)C)c3ccccc3n(CCCNCc3ccccc3)c2c1C |
| InChI | InChI=1S/C30H36N4O2.CH4/c1-22-15-16-26-29(32-36-20-17-28(35)33(3)4)25-13-8-9-14-27(25)34(30(26)23(22)2)19-10-18-31-21-24-11-6-5-7-12-24;/h5-9,11-16,31H,10,17-21H2,1-4H3;1H4/b32-29+; |
| InChIKey | UFAWFNAAGUCZSQ-GAIQWZQFSA-N |
| XLogP | 5.54 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|