C34H28Cl2F4N6O4 — CID 172929120
4-(4-chlorophenyl)-5-(3,5-difluoro-2-pyridinyl)-3-methyl-1H-pyridazin-6-one;(2Z)-1-(4-chlorophenyl)-2-hydrazinylidenepropan-1-one;ethyl 2-(3,5-difluoro-2-pyridinyl)acetate (PubChem CID 172929120) has the molecular formula C34H28Cl2F4N6O4 and a molecular weight of 731.53 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(3,5-difluoro-2-pyridinyl)-3-methyl-1H-pyridazin-6-one;(2Z)-1-(4-chlorophenyl)-2-hydrazinylidenepropan-1-one;ethyl 2-(3,5-difluoro-2-pyridinyl)acetate.
| Compound Name | 4-(4-chlorophenyl)-5-(3,5-difluoro-2-pyridinyl)-3-methyl-1H-pyridazin-6-one;(2Z)-1-(4-chlorophenyl)-2-hydrazinylidenepropan-1-one;ethyl 2-(3,5-difluoro-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 172929120 |
| Molecular Formula | C34H28Cl2F4N6O4 |
| Molecular Weight | 731.53 g/mol |
| Exact Mass | 730.15 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(3,5-difluoro-2-pyridinyl)-3-methyl-1H-pyridazin-6-one;(2Z)-1-(4-chlorophenyl)-2-hydrazinylidenepropan-1-one;ethyl 2-(3,5-difluoro-2-pyridinyl)acetate |
| SMILES | C/C(=N/N)C(=O)c1ccc(Cl)cc1.CCOC(=O)Cc1ncc(F)cc1F.Cc1n[nH]c(=O)c(-c2ncc(F)cc2F)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H10ClF2N3O.C9H9ClN2O.C9H9F2NO2/c1-8-13(9-2-4-10(17)5-3-9)14(16(23)22-21-8)15-12(19)6-11(18)7-20-15;1-6(12-11)9(13)7-2-4-8(10)5-3-7;1-2-14-9(13)4-8-7(11)3-6(10)5-12-8/h2-7H,1H3,(H,22,23);2-5H,11H2,1H3;3,5H,2,4H2,1H3/b;12-6-; |
| InChIKey | SCQDBHPDGAFIMF-MVGMRYSLSA-N |
| XLogP | 7.06 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.53 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|