C12H20Cl2N8O2 — CID 172929445
2-[(E)-1-[5-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-2,4-dihydroxyphenyl]ethylideneamino]guanidine;dihydrochloride (PubChem CID 172929445) has the molecular formula C12H20Cl2N8O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-[(E)-1-[5-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-2,4-dihydroxyphenyl]ethylideneamino]guanidine;dihydrochloride.
| Compound Name | 2-[(E)-1-[5-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-2,4-dihydroxyphenyl]ethylideneamino]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 172929445 |
| Molecular Formula | C12H20Cl2N8O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-[(E)-1-[5-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-2,4-dihydroxyphenyl]ethylideneamino]guanidine;dihydrochloride |
| SMILES | C/C(=N\N=C(N)N)c1cc(/C(C)=N/N=C(N)N)c(O)cc1O.Cl.Cl |
| InChI | InChI=1S/C12H18N8O2.2ClH/c1-5(17-19-11(13)14)7-3-8(10(22)4-9(7)21)6(2)18-20-12(15)16;;/h3-4,21-22H,1-2H3,(H4,13,14,19)(H4,15,16,20);2*1H/b17-5+,18-6+;; |
| InChIKey | FCTSDYMDXCGSGO-HPLLZCQRSA-N |
| XLogP | -0.06 |
| TPSA | 193.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|