C21H24N8O2 — CID 172930002
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl (NE,1Z)-N-[1-(1-propa-1,2-dienylpyrazol-3-yl)ethylidene]propanehydrazonate (PubChem CID 172930002) has the molecular formula C21H24N8O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl (NE,1Z)-N-[1-(1-propa-1,2-dienylpyrazol-3-yl)ethylidene]propanehydrazonate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl (NE,1Z)-N-[1-(1-propa-1,2-dienylpyrazol-3-yl)ethylidene]propanehydrazonate |
|---|---|
| PubChem CID | 172930002 |
| Molecular Formula | C21H24N8O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl (NE,1Z)-N-[1-(1-propa-1,2-dienylpyrazol-3-yl)ethylidene]propanehydrazonate |
| SMILES | C=C=Cn1ccc(/C(C)=N/N=C(/CC)OCc2c(C)cccc2-n2nnn(C)c2=O)n1 |
| InChI | InChI=1S/C21H24N8O2/c1-6-12-28-13-11-18(24-28)16(4)22-23-20(7-2)31-14-17-15(3)9-8-10-19(17)29-21(30)27(5)25-26-29/h8-13H,1,7,14H2,2-5H3/b22-16+,23-20- |
| InChIKey | PQWBURMGJIUZAU-QGANTCJASA-N |
| XLogP | 2.48 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|