C25H43N9O3 — CID 172930124
5,9,13-tricyano-2-N',6-N',10-N'-trihydroxy-2,2,14,14-tetramethylpentadecane-2,6,10-tricarboximidamide (PubChem CID 172930124) has the molecular formula C25H43N9O3 and a molecular weight of 517.68 g/mol. Its IUPAC name is 5,9,13-tricyano-2-N',6-N',10-N'-trihydroxy-2,2,14,14-tetramethylpentadecane-2,6,10-tricarboximidamide.
| Compound Name | 5,9,13-tricyano-2-N',6-N',10-N'-trihydroxy-2,2,14,14-tetramethylpentadecane-2,6,10-tricarboximidamide |
|---|---|
| PubChem CID | 172930124 |
| Molecular Formula | C25H43N9O3 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | 5,9,13-tricyano-2-N',6-N',10-N'-trihydroxy-2,2,14,14-tetramethylpentadecane-2,6,10-tricarboximidamide |
| SMILES | CC(C)(C)C(C#N)CC(CC(C#N)CC(CC(C#N)CC(C(N)=NO)C(C)(C)C)/C(N)=N/O)C(N)=NO |
| InChI | InChI=1S/C25H43N9O3/c1-24(2,3)19(14-28)11-18(22(30)33-36)8-15(12-26)7-17(21(29)32-35)9-16(13-27)10-20(23(31)34-37)25(4,5)6/h15-20,35-37H,7-11H2,1-6H3,(H2,29,32)(H2,30,33)(H2,31,34) |
| InChIKey | APVTULOFESDZBJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 247.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|