C16H24F4N4O8 — CID 172930327
(5Z)-5-amino-5-hydroxyiminopentanoic acid;4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]butanoic acid;ethyl 2,2-difluoroacetate (PubChem CID 172930327) has the molecular formula C16H24F4N4O8 and a molecular weight of 476.38 g/mol. Its IUPAC name is (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]butanoic acid;ethyl 2,2-difluoroacetate.
| Compound Name | (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]butanoic acid;ethyl 2,2-difluoroacetate |
|---|---|
| PubChem CID | 172930327 |
| Molecular Formula | C16H24F4N4O8 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (5Z)-5-amino-5-hydroxyiminopentanoic acid;4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]butanoic acid;ethyl 2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)F.N/C(CCCC(=O)O)=N\O.O=C(O)CCCc1noc(C(F)F)n1 |
| InChI | InChI=1S/C7H8F2N2O3.C5H10N2O3.C4H6F2O2/c8-6(9)7-10-4(11-14-7)2-1-3-5(12)13;6-4(7-10)2-1-3-5(8)9;1-2-8-4(7)3(5)6/h6H,1-3H2,(H,12,13);10H,1-3H2,(H2,6,7)(H,8,9);3H,2H2,1H3 |
| InChIKey | NLLUAJAOUSTQNG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 198.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|