C21H22N7O5S2+ — CID 172930596
(6R)-3-[3-(3-aminopyridin-1-ium-1-yl)prop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 172930596) has the molecular formula C21H22N7O5S2+ and a molecular weight of 516.59 g/mol. Its IUPAC name is (6R)-3-[3-(3-aminopyridin-1-ium-1-yl)prop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-[3-(3-aminopyridin-1-ium-1-yl)prop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 172930596 |
| Molecular Formula | C21H22N7O5S2+ |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (6R)-3-[3-(3-aminopyridin-1-ium-1-yl)prop-1-enyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(C=CC[n+]3cccc(N)c3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C21H21N7O5S2/c1-33-26-14(13-10-35-21(23)24-13)17(29)25-15-18(30)28-16(20(31)32)11(9-34-19(15)28)4-2-6-27-7-3-5-12(22)8-27/h2-5,7-8,10,15,19H,6,9,22H2,1H3,(H3-,23,24,25,29,31,32)/p+1/b4-2?,26-14-/t15?,19-/m1/s1 |
| InChIKey | CQZVXRCSILQFOK-URINIGMKSA-O |
| XLogP | -0.06 |
| TPSA | 177.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|