C27H31N3O10 — CID 172931315
(7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyethanehydrazonoyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 172931315) has the molecular formula C27H31N3O10 and a molecular weight of 557.56 g/mol. Its IUPAC name is (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyethanehydrazonoyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyethanehydrazonoyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 172931315 |
| Molecular Formula | C27H31N3O10 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyethanehydrazonoyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(/C(CO)=N\N)C[C@@H]3O[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H31N3O10/c1-10-22(32)13(28)6-17(39-10)40-15-8-27(37,16(9-31)30-29)7-12-19(15)26(36)21-20(24(12)34)23(33)11-4-3-5-14(38-2)18(11)25(21)35/h3-5,10,13,15,17,22,31-32,34,36-37H,6-9,28-29H2,1-2H3/b30-16-/t10-,13-,15-,17-,22+,27-/m0/s1 |
| InChIKey | AMQREAIRWQGENL-HNYBEUICSA-N |
| XLogP | -0.25 |
| TPSA | 227.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|