C9H7BrN6O2 — CID 172931772
(1Z)-2-amino-N-(5-bromo-2-nitroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172931772) has the molecular formula C9H7BrN6O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is (1Z)-2-amino-N-(5-bromo-2-nitroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(5-bromo-2-nitroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172931772 |
| Molecular Formula | C9H7BrN6O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (1Z)-2-amino-N-(5-bromo-2-nitroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7BrN6O2/c10-5-1-2-8(16(17)18)6(3-5)14-15-7(4-11)9(12)13/h1-3,14H,(H3,12,13)/b15-7+ |
| InChIKey | FXJNWPZGQWKGSH-VIZOYTHASA-N |
| XLogP | 1.58 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|