C28H22F3N5O4 — CID 172932840
4-formyl-N-pyridin-1-ium-1-ylbenzenecarboximidate;N-pyridin-1-ium-1-yl-4-[(E)-2,2,2-trifluoroethoxyiminomethyl]benzenecarboximidate (PubChem CID 172932840) has the molecular formula C28H22F3N5O4 and a molecular weight of 549.51 g/mol. Its IUPAC name is 4-formyl-N-pyridin-1-ium-1-ylbenzenecarboximidate;N-pyridin-1-ium-1-yl-4-[(E)-2,2,2-trifluoroethoxyiminomethyl]benzenecarboximidate.
| Compound Name | 4-formyl-N-pyridin-1-ium-1-ylbenzenecarboximidate;N-pyridin-1-ium-1-yl-4-[(E)-2,2,2-trifluoroethoxyiminomethyl]benzenecarboximidate |
|---|---|
| PubChem CID | 172932840 |
| Molecular Formula | C28H22F3N5O4 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 4-formyl-N-pyridin-1-ium-1-ylbenzenecarboximidate;N-pyridin-1-ium-1-yl-4-[(E)-2,2,2-trifluoroethoxyiminomethyl]benzenecarboximidate |
| SMILES | O=Cc1ccc(C([O-])=N[n+]2ccccc2)cc1.[O-]C(=N[n+]1ccccc1)c1ccc(/C=N/OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3N3O2.C13H10N2O2/c16-15(17,18)11-23-19-10-12-4-6-13(7-5-12)14(22)20-21-8-2-1-3-9-21;16-10-11-4-6-12(7-5-11)13(17)14-15-8-2-1-3-9-15/h1-10H,11H2;1-10H/b19-10+; |
| InChIKey | MADAPBCBFFEXBB-ZIOFAICLSA-N |
| XLogP | 1.81 |
| TPSA | 117.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|