C16H14ClN7O5S4 — CID 172932893
(6R)-7-[[(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 172932893) has the molecular formula C16H14ClN7O5S4 and a molecular weight of 548.05 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 172932893 |
| Molecular Formula | C16H14ClN7O5S4 |
| Molecular Weight | 548.05 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethylsulfanyl)-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)NC2C(=O)N3C(C(=O)O)=C(SCSc4nncs4)CC[C@H]23)c(Cl)s1 |
| InChI | InChI=1S/C16H14ClN7O5S4/c17-11-8(21-15(18)33-11)9(23-29)12(25)20-7-5-1-2-6(10(14(27)28)24(5)13(7)26)31-4-32-16-22-19-3-30-16/h3,5,7,29H,1-2,4H2,(H2,18,21)(H,20,25)(H,27,28)/b23-9-/t5-,7?/m1/s1 |
| InChIKey | CPSWITLZAKRKIQ-IUNODUDXSA-N |
| XLogP | 1.68 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.05 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|