C25H28F3NO5 — CID 172934718
(E)-1-[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]-N-[(3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 172934718) has the molecular formula C25H28F3NO5 and a molecular weight of 479.50 g/mol. Its IUPAC name is (E)-1-[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]-N-[(3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]-N-[(3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 172934718 |
| Molecular Formula | C25H28F3NO5 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (E)-1-[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]-N-[(3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H](OC)C(O/N=C/c2ccc(/C=C/c3cccc(C(F)(F)F)c3)cc2)O[C@H]1C |
| InChI | InChI=1S/C25H28F3NO5/c1-16-21(30-2)22(31-3)23(32-4)24(33-16)34-29-15-19-12-9-17(10-13-19)8-11-18-6-5-7-20(14-18)25(26,27)28/h5-16,21-24H,1-4H3/b11-8+,29-15+/t16-,21-,22+,23+,24?/m0/s1 |
| InChIKey | QTMVTSKKKOQPAH-PLYYOWMBSA-N |
| XLogP | 5.02 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|