About CID 172934747
CID 172934747 (PubChem CID 172934747) has the molecular formula C20H23BFNO3
and a molecular weight of 355.22 g/mol.
Molecular Properties
| Compound Name | CID 172934747 |
| PubChem CID | 172934747 |
| Molecular Formula | C20H23BFNO3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | — |
| SMILES | [B][C@@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](F)/C=N/OC |
| InChI | InChI=1S/C20H23BFNO3/c1-24-23-12-19(22)20(26-14-17-10-6-3-7-11-17)18(21)15-25-13-16-8-4-2-5-9-16/h2-12,18-20H,13-15H2,1H3/b23-12+/t18-,19+,20+/m0/s1 |
| InChIKey | NVMGIMJPRCAJCA-FEFLBEBXSA-N |
| XLogP | 3.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 172934747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172934747?
The IUPAC name of CID 172934747 (CID 172934747) is not available.
What is the SMILES notation for CID 172934747?
The canonical SMILES for CID 172934747 is [B][C@@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](F)/C=N/OC.
What is the InChIKey of CID 172934747?
The InChIKey is NVMGIMJPRCAJCA-FEFLBEBXSA-N. The full InChI is InChI=1S/C20H23BFNO3/c1-24-23-12-19(22)20(26-14-17-10-6-3-7-11-17)18(21)15-25-13-16-8-4-2-5-9-16/h2-12,18-20H,13-15H2,1H3/b23-12+/t18-,19+,20+/m0/s1.
What are the key properties of CID 172934747?
CID 172934747 has a molecular weight of 355.22 g/mol, XLogP of 3.72, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172934747 is sourced from PubChem (CID 172934747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).