C22H31F6N7OS — CID 172935171
1-[4-[3-oxo-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]propyl]piperazin-1-yl]ethyl (1Z)-N-amino-2,2,2-trifluoroethanimidothioate (PubChem CID 172935171) has the molecular formula C22H31F6N7OS and a molecular weight of 555.59 g/mol. Its IUPAC name is 1-[4-[3-oxo-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]propyl]piperazin-1-yl]ethyl (1Z)-N-amino-2,2,2-trifluoroethanimidothioate.
| Compound Name | 1-[4-[3-oxo-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]propyl]piperazin-1-yl]ethyl (1Z)-N-amino-2,2,2-trifluoroethanimidothioate |
|---|---|
| PubChem CID | 172935171 |
| Molecular Formula | C22H31F6N7OS |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 1-[4-[3-oxo-3-[4-[[5-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]propyl]piperazin-1-yl]ethyl (1Z)-N-amino-2,2,2-trifluoroethanimidothioate |
| SMILES | CC(S/C(=N\N)C(F)(F)F)N1CCN(CCC(=O)N2CCC(Nc3ccc(C(F)(F)F)cn3)CC2)CC1 |
| InChI | InChI=1S/C22H31F6N7OS/c1-15(37-20(32-29)22(26,27)28)34-12-10-33(11-13-34)7-6-19(36)35-8-4-17(5-9-35)31-18-3-2-16(14-30-18)21(23,24)25/h2-3,14-15,17H,4-13,29H2,1H3,(H,30,31)/b32-20- |
| InChIKey | SAIKHMRQDKIZOV-RGXNXFOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|