C44H40Cl2N6 — CID 172936128
(NZ,Z)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride;2,6-dimethylaniline;4-(2,6-dimethylphenyl)-3,5-diphenyl-1,2,4-triazole (PubChem CID 172936128) has the molecular formula C44H40Cl2N6 and a molecular weight of 723.75 g/mol. Its IUPAC name is (NZ,Z)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride;2,6-dimethylaniline;4-(2,6-dimethylphenyl)-3,5-diphenyl-1,2,4-triazole.
| Compound Name | (NZ,Z)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride;2,6-dimethylaniline;4-(2,6-dimethylphenyl)-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 172936128 |
| Molecular Formula | C44H40Cl2N6 |
| Molecular Weight | 723.75 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | (NZ,Z)-N-[chloro(phenyl)methylidene]benzenecarbohydrazonoyl chloride;2,6-dimethylaniline;4-(2,6-dimethylphenyl)-3,5-diphenyl-1,2,4-triazole |
| SMILES | Cc1cccc(C)c1-n1c(-c2ccccc2)nnc1-c1ccccc1.Cc1cccc(C)c1N.Cl/C(=N\N=C(/Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3.C14H10Cl2N2.C8H11N/c1-16-10-9-11-17(2)20(16)25-21(18-12-5-3-6-13-18)23-24-22(25)19-14-7-4-8-15-19;15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-6-4-3-5-7(2)8(6)9/h3-15H,1-2H3;1-10H;3-5H,9H2,1-2H3/b;17-13-,18-14-; |
| InChIKey | RBDUVKYELYMOKF-ACIDLJRWSA-N |
| XLogP | 11.38 |
| TPSA | 81.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.75 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|