About N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride
N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride (PubChem CID 17293725) has the molecular formula C11H16Cl3N
and a molecular weight of 268.61 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride |
| PubChem CID | 17293725 |
| Molecular Formula | C11H16Cl3N |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H15Cl2N.ClH/c1-2-3-6-14-8-9-4-5-10(12)11(13)7-9;/h4-5,7,14H,2-3,6,8H2,1H3;1H |
| InChIKey | VVMWVPDJSLDYGS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride (CID 17293725) is N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride is CCCCNCc1ccc(Cl)c(Cl)c1.Cl.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride?
The InChIKey is VVMWVPDJSLDYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2N.ClH/c1-2-3-6-14-8-9-4-5-10(12)11(13)7-9;/h4-5,7,14H,2-3,6,8H2,1H3;1H.
What are the key properties of N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride?
N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride has a molecular weight of 268.61 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]butan-1-amine;hydrochloride is sourced from PubChem (CID 17293725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).