C25H27FN4O5 — CID 172937317
(E)-1-[2-[5-fluoro-6-(2-methylphenoxy)pyrimidin-4-yl]oxyphenyl]-N-methoxy-1-(2-methyl-1,6,2-dioxazocan-5-yl)methanimine (PubChem CID 172937317) has the molecular formula C25H27FN4O5 and a molecular weight of 482.51 g/mol. Its IUPAC name is (E)-1-[2-[5-fluoro-6-(2-methylphenoxy)pyrimidin-4-yl]oxyphenyl]-N-methoxy-1-(2-methyl-1,6,2-dioxazocan-5-yl)methanimine.
| Compound Name | (E)-1-[2-[5-fluoro-6-(2-methylphenoxy)pyrimidin-4-yl]oxyphenyl]-N-methoxy-1-(2-methyl-1,6,2-dioxazocan-5-yl)methanimine |
|---|---|
| PubChem CID | 172937317 |
| Molecular Formula | C25H27FN4O5 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (E)-1-[2-[5-fluoro-6-(2-methylphenoxy)pyrimidin-4-yl]oxyphenyl]-N-methoxy-1-(2-methyl-1,6,2-dioxazocan-5-yl)methanimine |
| SMILES | CO/N=C(\c1ccccc1Oc1ncnc(Oc2ccccc2C)c1F)C1CCN(C)OCCO1 |
| InChI | InChI=1S/C25H27FN4O5/c1-17-8-4-6-10-19(17)34-24-22(26)25(28-16-27-24)35-20-11-7-5-9-18(20)23(29-31-3)21-12-13-30(2)33-15-14-32-21/h4-11,16,21H,12-15H2,1-3H3/b29-23+ |
| InChIKey | XWHKXNWMLQICNB-BYNJWEBRSA-N |
| XLogP | 4.51 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|