C28H24ClFN2O4 — CID 172937342
4-[4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-2-oxo-3,4-dihydropyridin-5-yl)propyl]phenyl]-2-fluorobenzoic acid (PubChem CID 172937342) has the molecular formula C28H24ClFN2O4 and a molecular weight of 506.96 g/mol. Its IUPAC name is 4-[4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-2-oxo-3,4-dihydropyridin-5-yl)propyl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-2-oxo-3,4-dihydropyridin-5-yl)propyl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 172937342 |
| Molecular Formula | C28H24ClFN2O4 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-[4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-2-oxo-3,4-dihydropyridin-5-yl)propyl]phenyl]-2-fluorobenzoic acid |
| SMILES | CN1C=C(/C(CC(c2ccc(-c3ccc(C(=O)O)c(F)c3)cc2)c2ccccc2Cl)=N/O)CCC1=O |
| InChI | InChI=1S/C28H24ClFN2O4/c1-32-16-20(11-13-27(32)33)26(31-36)15-23(21-4-2-3-5-24(21)29)18-8-6-17(7-9-18)19-10-12-22(28(34)35)25(30)14-19/h2-10,12,14,16,23,36H,11,13,15H2,1H3,(H,34,35)/b31-26+ |
| InChIKey | XYPXELLOSNQBON-GKPLWNPISA-N |
| XLogP | 6.33 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|