About (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine
(NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine (PubChem CID 172938099) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine |
| PubChem CID | 172938099 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine |
| SMILES | Cc1sc(/C=N\O)c(C)c1C |
| InChI | InChI=1S/C8H11NOS/c1-5-6(2)8(4-9-10)11-7(5)3/h4,10H,1-3H3/b9-4- |
| InChIKey | DWDMCFARDCEGQT-WTKPLQERSA-N |
| XLogP | 2.48 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine (CID 172938099) is (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine is Cc1sc(/C=N\O)c(C)c1C.
What is the InChIKey of (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine?
The InChIKey is DWDMCFARDCEGQT-WTKPLQERSA-N. The full InChI is InChI=1S/C8H11NOS/c1-5-6(2)8(4-9-10)11-7(5)3/h4,10H,1-3H3/b9-4-.
What are the key properties of (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine?
(NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine has a molecular weight of 169.25 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(3,4,5-trimethylthiophen-2-yl)methylidene]hydroxylamine is sourced from PubChem (CID 172938099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).