C9H11N3S2 — CID 172938912
prop-2-enyl N'-(thiophen-3-ylmethylideneamino)carbamimidothioate (PubChem CID 172938912) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is prop-2-enyl N'-(thiophen-3-ylmethylideneamino)carbamimidothioate.
| Compound Name | prop-2-enyl N'-(thiophen-3-ylmethylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 172938912 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | prop-2-enyl N'-(thiophen-3-ylmethylideneamino)carbamimidothioate |
| SMILES | C=CCS/C(N)=N\N=Cc1ccsc1 |
| InChI | InChI=1S/C9H11N3S2/c1-2-4-14-9(10)12-11-6-8-3-5-13-7-8/h2-3,5-7H,1,4H2,(H2,10,12) |
| InChIKey | NUOKZNPHEBPIGE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|